About 5-(5-amino-1,2-oxazol-4-yl)-4-fluoro-2-methylphenol
5-(5-amino-1,2-oxazol-4-yl)-4-fluoro-2-methylphenol (PubChem CID 117297099) has the molecular formula C10H9FN2O2
and a molecular weight of 208.19 g/mol. Its IUPAC name is 5-(5-amino-1,2-oxazol-4-yl)-4-fluoro-2-methylphenol.
Molecular Properties
| Compound Name | 5-(5-amino-1,2-oxazol-4-yl)-4-fluoro-2-methylphenol |
| PubChem CID | 117297099 |
| Molecular Formula | C10H9FN2O2 |
| Molecular Weight | 208.19 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 5-(5-amino-1,2-oxazol-4-yl)-4-fluoro-2-methylphenol |
| SMILES | Cc1cc(F)c(-c2cnoc2N)cc1O |
| InChI | InChI=1S/C10H9FN2O2/c1-5-2-8(11)6(3-9(5)14)7-4-13-15-10(7)12/h2-4,14H,12H2,1H3 |
| InChIKey | PEDZYHDQSKQNIV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.19 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(5-amino-1,2-oxazol-4-yl)-4-fluoro-2-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-amino-1,2-oxazol-4-yl)-4-fluoro-2-methylphenol?
The IUPAC name of 5-(5-amino-1,2-oxazol-4-yl)-4-fluoro-2-methylphenol (CID 117297099) is 5-(5-amino-1,2-oxazol-4-yl)-4-fluoro-2-methylphenol.
What is the SMILES notation for 5-(5-amino-1,2-oxazol-4-yl)-4-fluoro-2-methylphenol?
The canonical SMILES for 5-(5-amino-1,2-oxazol-4-yl)-4-fluoro-2-methylphenol is Cc1cc(F)c(-c2cnoc2N)cc1O.
What is the InChIKey of 5-(5-amino-1,2-oxazol-4-yl)-4-fluoro-2-methylphenol?
The InChIKey is PEDZYHDQSKQNIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FN2O2/c1-5-2-8(11)6(3-9(5)14)7-4-13-15-10(7)12/h2-4,14H,12H2,1H3.
What are the key properties of 5-(5-amino-1,2-oxazol-4-yl)-4-fluoro-2-methylphenol?
5-(5-amino-1,2-oxazol-4-yl)-4-fluoro-2-methylphenol has a molecular weight of 208.19 g/mol, XLogP of 2.08, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-amino-1,2-oxazol-4-yl)-4-fluoro-2-methylphenol is sourced from PubChem (CID 117297099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).