C18H28N2O8S — CID 11729717
methyl 2-[(1S,3S)-4-ethoxy-3-(methoxymethoxy)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutyl]-1,3-thiazole-4-carboxylate (PubChem CID 11729717) has the molecular formula C18H28N2O8S and a molecular weight of 432.50 g/mol. Its IUPAC name is methyl 2-[(1S,3S)-4-ethoxy-3-(methoxymethoxy)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[(1S,3S)-4-ethoxy-3-(methoxymethoxy)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 11729717 |
| Molecular Formula | C18H28N2O8S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | methyl 2-[(1S,3S)-4-ethoxy-3-(methoxymethoxy)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)[C@H](C[C@H](NC(=O)OC(C)(C)C)c1nc(C(=O)OC)cs1)OCOC |
| InChI | InChI=1S/C18H28N2O8S/c1-7-26-16(22)13(27-10-24-5)8-11(20-17(23)28-18(2,3)4)14-19-12(9-29-14)15(21)25-6/h9,11,13H,7-8,10H2,1-6H3,(H,20,23)/t11-,13-/m0/s1 |
| InChIKey | QOAQLEGDQITFIW-AAEUAGOBSA-N |
| XLogP | 2.44 |
| TPSA | 122.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|