C24H18O8 — CID 11729754
1-(3-acetyl-2,4-dihydroxy-6-methoxyphenyl)-4,5-dihydroxy-2-methylanthracene-9,10-dione (PubChem CID 11729754) has the molecular formula C24H18O8 and a molecular weight of 434.40 g/mol. Its IUPAC name is 1-(3-acetyl-2,4-dihydroxy-6-methoxyphenyl)-4,5-dihydroxy-2-methylanthracene-9,10-dione.
| Compound Name | 1-(3-acetyl-2,4-dihydroxy-6-methoxyphenyl)-4,5-dihydroxy-2-methylanthracene-9,10-dione |
|---|---|
| PubChem CID | 11729754 |
| Molecular Formula | C24H18O8 |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 1-(3-acetyl-2,4-dihydroxy-6-methoxyphenyl)-4,5-dihydroxy-2-methylanthracene-9,10-dione |
| SMILES | COc1cc(O)c(C(C)=O)c(O)c1-c1c(C)cc(O)c2c1C(=O)c1cccc(O)c1C2=O |
| InChI | InChI=1S/C24H18O8/c1-9-7-13(27)19-21(22(29)11-5-4-6-12(26)18(11)24(19)31)16(9)20-15(32-3)8-14(28)17(10(2)25)23(20)30/h4-8,26-28,30H,1-3H3 |
| InChIKey | YSWIJPRDSZZOMY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|