About 2-fluoro-N,N-dimethyl-4-pyrrolidin-3-ylaniline
2-fluoro-N,N-dimethyl-4-pyrrolidin-3-ylaniline (PubChem CID 117297873) has the molecular formula C12H17FN2
and a molecular weight of 208.28 g/mol. Its IUPAC name is 2-fluoro-N,N-dimethyl-4-pyrrolidin-3-ylaniline.
Molecular Properties
| Compound Name | 2-fluoro-N,N-dimethyl-4-pyrrolidin-3-ylaniline |
| PubChem CID | 117297873 |
| Molecular Formula | C12H17FN2 |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | 2-fluoro-N,N-dimethyl-4-pyrrolidin-3-ylaniline |
| SMILES | CN(C)c1ccc(C2CCNC2)cc1F |
| InChI | InChI=1S/C12H17FN2/c1-15(2)12-4-3-9(7-11(12)13)10-5-6-14-8-10/h3-4,7,10,14H,5-6,8H2,1-2H3 |
| InChIKey | RASAMMYEWMPQIY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-fluoro-N,N-dimethyl-4-pyrrolidin-3-ylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N,N-dimethyl-4-pyrrolidin-3-ylaniline?
The IUPAC name of 2-fluoro-N,N-dimethyl-4-pyrrolidin-3-ylaniline (CID 117297873) is 2-fluoro-N,N-dimethyl-4-pyrrolidin-3-ylaniline.
What is the SMILES notation for 2-fluoro-N,N-dimethyl-4-pyrrolidin-3-ylaniline?
The canonical SMILES for 2-fluoro-N,N-dimethyl-4-pyrrolidin-3-ylaniline is CN(C)c1ccc(C2CCNC2)cc1F.
What is the InChIKey of 2-fluoro-N,N-dimethyl-4-pyrrolidin-3-ylaniline?
The InChIKey is RASAMMYEWMPQIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17FN2/c1-15(2)12-4-3-9(7-11(12)13)10-5-6-14-8-10/h3-4,7,10,14H,5-6,8H2,1-2H3.
What are the key properties of 2-fluoro-N,N-dimethyl-4-pyrrolidin-3-ylaniline?
2-fluoro-N,N-dimethyl-4-pyrrolidin-3-ylaniline has a molecular weight of 208.28 g/mol, XLogP of 1.97, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N,N-dimethyl-4-pyrrolidin-3-ylaniline is sourced from PubChem (CID 117297873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).