About 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-4-fluorophenol
3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-4-fluorophenol (PubChem CID 117298189) has the molecular formula C9H8FN3O2
and a molecular weight of 209.18 g/mol. Its IUPAC name is 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-4-fluorophenol.
Molecular Properties
| Compound Name | 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-4-fluorophenol |
| PubChem CID | 117298189 |
| Molecular Formula | C9H8FN3O2 |
| Molecular Weight | 209.18 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-4-fluorophenol |
| SMILES | NCc1nc(-c2cc(O)ccc2F)no1 |
| InChI | InChI=1S/C9H8FN3O2/c10-7-2-1-5(14)3-6(7)9-12-8(4-11)15-13-9/h1-3,14H,4,11H2 |
| InChIKey | YTJRLIIPMOVFHJ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.18 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-4-fluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-4-fluorophenol?
The IUPAC name of 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-4-fluorophenol (CID 117298189) is 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-4-fluorophenol.
What is the SMILES notation for 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-4-fluorophenol?
The canonical SMILES for 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-4-fluorophenol is NCc1nc(-c2cc(O)ccc2F)no1.
What is the InChIKey of 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-4-fluorophenol?
The InChIKey is YTJRLIIPMOVFHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8FN3O2/c10-7-2-1-5(14)3-6(7)9-12-8(4-11)15-13-9/h1-3,14H,4,11H2.
What are the key properties of 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-4-fluorophenol?
3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-4-fluorophenol has a molecular weight of 209.18 g/mol, XLogP of 1.04, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-4-fluorophenol is sourced from PubChem (CID 117298189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).