C28H27N3O2 — CID 11729833
2-[[(15S,19S)-15-ethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18),16-pentaen-17-yl]methyl]isoindole-1,3-dione (PubChem CID 11729833) has the molecular formula C28H27N3O2 and a molecular weight of 437.54 g/mol. Its IUPAC name is 2-[[(15S,19S)-15-ethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18),16-pentaen-17-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[(15S,19S)-15-ethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18),16-pentaen-17-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 11729833 |
| Molecular Formula | C28H27N3O2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 2-[[(15S,19S)-15-ethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18),16-pentaen-17-yl]methyl]isoindole-1,3-dione |
| SMILES | CC[C@@]12C=C(CN3C(=O)c4ccccc4C3=O)n3c4c(c5ccccc53)CCN(CCC1)[C@H]42 |
| InChI | InChI=1S/C28H27N3O2/c1-2-28-13-7-14-29-15-12-20-19-8-5-6-11-23(19)31(24(20)25(28)29)18(16-28)17-30-26(32)21-9-3-4-10-22(21)27(30)33/h3-6,8-11,16,25H,2,7,12-15,17H2,1H3/t25-,28+/m1/s1 |
| InChIKey | CQJLVFWZQPGYMB-NAKRPHOHSA-N |
| XLogP | 4.88 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|