About 6-[[3-(4-bromophenyl)-1,2-benzoxazol-6-yl]oxy]-N-methyl-N-prop-2-enylhexan-1-amine
6-[[3-(4-bromophenyl)-1,2-benzoxazol-6-yl]oxy]-N-methyl-N-prop-2-enylhexan-1-amine (PubChem CID 11729939) has the molecular formula C23H27BrN2O2
and a molecular weight of 443.39 g/mol. Its IUPAC name is 6-[[3-(4-bromophenyl)-1,2-benzoxazol-6-yl]oxy]-N-methyl-N-prop-2-enylhexan-1-amine.
Molecular Properties
| Compound Name | 6-[[3-(4-bromophenyl)-1,2-benzoxazol-6-yl]oxy]-N-methyl-N-prop-2-enylhexan-1-amine |
| PubChem CID | 11729939 |
| Molecular Formula | C23H27BrN2O2 |
| Molecular Weight | 443.39 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 6-[[3-(4-bromophenyl)-1,2-benzoxazol-6-yl]oxy]-N-methyl-N-prop-2-enylhexan-1-amine |
| SMILES | C=CCN(C)CCCCCCOc1ccc2c(-c3ccc(Br)cc3)noc2c1 |
| InChI | InChI=1S/C23H27BrN2O2/c1-3-14-26(2)15-6-4-5-7-16-27-20-12-13-21-22(17-20)28-25-23(21)18-8-10-19(24)11-9-18/h3,8-13,17H,1,4-7,14-16H2,2H3 |
| InChIKey | VCDXTQIRGMIUCZ-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.39 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-[[3-(4-bromophenyl)-1,2-benzoxazol-6-yl]oxy]-N-methyl-N-prop-2-enylhexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[3-(4-bromophenyl)-1,2-benzoxazol-6-yl]oxy]-N-methyl-N-prop-2-enylhexan-1-amine?
The IUPAC name of 6-[[3-(4-bromophenyl)-1,2-benzoxazol-6-yl]oxy]-N-methyl-N-prop-2-enylhexan-1-amine (CID 11729939) is 6-[[3-(4-bromophenyl)-1,2-benzoxazol-6-yl]oxy]-N-methyl-N-prop-2-enylhexan-1-amine.
What is the SMILES notation for 6-[[3-(4-bromophenyl)-1,2-benzoxazol-6-yl]oxy]-N-methyl-N-prop-2-enylhexan-1-amine?
The canonical SMILES for 6-[[3-(4-bromophenyl)-1,2-benzoxazol-6-yl]oxy]-N-methyl-N-prop-2-enylhexan-1-amine is C=CCN(C)CCCCCCOc1ccc2c(-c3ccc(Br)cc3)noc2c1.
What is the InChIKey of 6-[[3-(4-bromophenyl)-1,2-benzoxazol-6-yl]oxy]-N-methyl-N-prop-2-enylhexan-1-amine?
The InChIKey is VCDXTQIRGMIUCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27BrN2O2/c1-3-14-26(2)15-6-4-5-7-16-27-20-12-13-21-22(17-20)28-25-23(21)18-8-10-19(24)11-9-18/h3,8-13,17H,1,4-7,14-16H2,2H3.
What are the key properties of 6-[[3-(4-bromophenyl)-1,2-benzoxazol-6-yl]oxy]-N-methyl-N-prop-2-enylhexan-1-amine?
6-[[3-(4-bromophenyl)-1,2-benzoxazol-6-yl]oxy]-N-methyl-N-prop-2-enylhexan-1-amine has a molecular weight of 443.39 g/mol, XLogP of 6.31, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[3-(4-bromophenyl)-1,2-benzoxazol-6-yl]oxy]-N-methyl-N-prop-2-enylhexan-1-amine is sourced from PubChem (CID 11729939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).