C20H38NO6PSi — CID 11730026
5-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]pent-2-ynyl diethyl phosphate (PubChem CID 11730026) has the molecular formula C20H38NO6PSi and a molecular weight of 447.59 g/mol. Its IUPAC name is 5-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]pent-2-ynyl diethyl phosphate.
| Compound Name | 5-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]pent-2-ynyl diethyl phosphate |
|---|---|
| PubChem CID | 11730026 |
| Molecular Formula | C20H38NO6PSi |
| Molecular Weight | 447.59 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 5-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]pent-2-ynyl diethyl phosphate |
| SMILES | CCOP(=O)(OCC)OCC#CCC[C@H]1NC(=O)[C@@H]1[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H38NO6PSi/c1-9-24-28(23,25-10-2)26-15-13-11-12-14-17-18(19(22)21-17)16(3)27-29(7,8)20(4,5)6/h16-18H,9-10,12,14-15H2,1-8H3,(H,21,22)/t16-,17-,18-/m1/s1 |
| InChIKey | HHDSXJCSHJJBEA-KZNAEPCWSA-N |
| XLogP | 4.49 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.59 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|