C14H21N4O11P — CID 11730103
3-[2,4,7-trioxo-8-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-1H-pteridin-6-yl]propyl dihydrogen phosphate (PubChem CID 11730103) has the molecular formula C14H21N4O11P and a molecular weight of 452.31 g/mol. Its IUPAC name is 3-[2,4,7-trioxo-8-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-1H-pteridin-6-yl]propyl dihydrogen phosphate.
| Compound Name | 3-[2,4,7-trioxo-8-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-1H-pteridin-6-yl]propyl dihydrogen phosphate |
|---|---|
| PubChem CID | 11730103 |
| Molecular Formula | C14H21N4O11P |
| Molecular Weight | 452.31 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | 3-[2,4,7-trioxo-8-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-1H-pteridin-6-yl]propyl dihydrogen phosphate |
| SMILES | O=c1[nH]c(=O)c2nc(CCCOP(=O)(O)O)c(=O)n(C[C@H](O)[C@H](O)[C@H](O)CO)c2[nH]1 |
| InChI | InChI=1S/C14H21N4O11P/c19-5-8(21)10(22)7(20)4-18-11-9(12(23)17-14(25)16-11)15-6(13(18)24)2-1-3-29-30(26,27)28/h7-8,10,19-22H,1-5H2,(H2,26,27,28)(H2,16,17,23,25)/t7-,8+,10-/m0/s1 |
| InChIKey | URBYNSQKZFYCOM-XKSSXDPKSA-N |
| XLogP | -4.11 |
| TPSA | 248.29 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.31 |
| LogP ≤ 5 | -4.11 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|