C12H15F2N — CID 117301607
[1-[3-(difluoromethyl)phenyl]cyclobutyl]methanamine (PubChem CID 117301607) has the molecular formula C12H15F2N and a molecular weight of 211.26 g/mol. Its IUPAC name is [1-[3-(difluoromethyl)phenyl]cyclobutyl]methanamine.
| Compound Name | [1-[3-(difluoromethyl)phenyl]cyclobutyl]methanamine |
|---|---|
| PubChem CID | 117301607 |
| Molecular Formula | C12H15F2N |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | [1-[3-(difluoromethyl)phenyl]cyclobutyl]methanamine |
| SMILES | NCC1(c2cccc(C(F)F)c2)CCC1 |
| InChI | InChI=1S/C12H15F2N/c13-11(14)9-3-1-4-10(7-9)12(8-15)5-2-6-12/h1,3-4,7,11H,2,5-6,8,15H2 |
| InChIKey | KRZRYPVCHUUABN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |