About N-[(2,2-dimethyl-1,3-benzoxathiol-7-yl)methyl]hydroxylamine
N-[(2,2-dimethyl-1,3-benzoxathiol-7-yl)methyl]hydroxylamine (PubChem CID 117302060) has the molecular formula C10H13NO2S
and a molecular weight of 211.29 g/mol. Its IUPAC name is N-[(2,2-dimethyl-1,3-benzoxathiol-7-yl)methyl]hydroxylamine.
Molecular Properties
| Compound Name | N-[(2,2-dimethyl-1,3-benzoxathiol-7-yl)methyl]hydroxylamine |
| PubChem CID | 117302060 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | N-[(2,2-dimethyl-1,3-benzoxathiol-7-yl)methyl]hydroxylamine |
| SMILES | CC1(C)Oc2c(CNO)cccc2S1 |
| InChI | InChI=1S/C10H13NO2S/c1-10(2)13-9-7(6-11-12)4-3-5-8(9)14-10/h3-5,11-12H,6H2,1-2H3 |
| InChIKey | YWBUIPUYZAOKAL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(2,2-dimethyl-1,3-benzoxathiol-7-yl)methyl]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,2-dimethyl-1,3-benzoxathiol-7-yl)methyl]hydroxylamine?
The IUPAC name of N-[(2,2-dimethyl-1,3-benzoxathiol-7-yl)methyl]hydroxylamine (CID 117302060) is N-[(2,2-dimethyl-1,3-benzoxathiol-7-yl)methyl]hydroxylamine.
What is the SMILES notation for N-[(2,2-dimethyl-1,3-benzoxathiol-7-yl)methyl]hydroxylamine?
The canonical SMILES for N-[(2,2-dimethyl-1,3-benzoxathiol-7-yl)methyl]hydroxylamine is CC1(C)Oc2c(CNO)cccc2S1.
What is the InChIKey of N-[(2,2-dimethyl-1,3-benzoxathiol-7-yl)methyl]hydroxylamine?
The InChIKey is YWBUIPUYZAOKAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2S/c1-10(2)13-9-7(6-11-12)4-3-5-8(9)14-10/h3-5,11-12H,6H2,1-2H3.
What are the key properties of N-[(2,2-dimethyl-1,3-benzoxathiol-7-yl)methyl]hydroxylamine?
N-[(2,2-dimethyl-1,3-benzoxathiol-7-yl)methyl]hydroxylamine has a molecular weight of 211.29 g/mol, XLogP of 2.39, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,2-dimethyl-1,3-benzoxathiol-7-yl)methyl]hydroxylamine is sourced from PubChem (CID 117302060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).