About 3-(3-amino-1,2-oxazol-5-yl)-2,4-difluorophenol
3-(3-amino-1,2-oxazol-5-yl)-2,4-difluorophenol (PubChem CID 117302447) has the molecular formula C9H6F2N2O2
and a molecular weight of 212.16 g/mol. Its IUPAC name is 3-(3-amino-1,2-oxazol-5-yl)-2,4-difluorophenol.
Molecular Properties
| Compound Name | 3-(3-amino-1,2-oxazol-5-yl)-2,4-difluorophenol |
| PubChem CID | 117302447 |
| Molecular Formula | C9H6F2N2O2 |
| Molecular Weight | 212.16 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 3-(3-amino-1,2-oxazol-5-yl)-2,4-difluorophenol |
| SMILES | Nc1cc(-c2c(F)ccc(O)c2F)on1 |
| InChI | InChI=1S/C9H6F2N2O2/c10-4-1-2-5(14)9(11)8(4)6-3-7(12)13-15-6/h1-3,14H,(H2,12,13) |
| InChIKey | MRNWKIAVKBYYDK-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.16 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3-amino-1,2-oxazol-5-yl)-2,4-difluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-amino-1,2-oxazol-5-yl)-2,4-difluorophenol?
The IUPAC name of 3-(3-amino-1,2-oxazol-5-yl)-2,4-difluorophenol (CID 117302447) is 3-(3-amino-1,2-oxazol-5-yl)-2,4-difluorophenol.
What is the SMILES notation for 3-(3-amino-1,2-oxazol-5-yl)-2,4-difluorophenol?
The canonical SMILES for 3-(3-amino-1,2-oxazol-5-yl)-2,4-difluorophenol is Nc1cc(-c2c(F)ccc(O)c2F)on1.
What is the InChIKey of 3-(3-amino-1,2-oxazol-5-yl)-2,4-difluorophenol?
The InChIKey is MRNWKIAVKBYYDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F2N2O2/c10-4-1-2-5(14)9(11)8(4)6-3-7(12)13-15-6/h1-3,14H,(H2,12,13).
What are the key properties of 3-(3-amino-1,2-oxazol-5-yl)-2,4-difluorophenol?
3-(3-amino-1,2-oxazol-5-yl)-2,4-difluorophenol has a molecular weight of 212.16 g/mol, XLogP of 1.91, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-amino-1,2-oxazol-5-yl)-2,4-difluorophenol is sourced from PubChem (CID 117302447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).