C11H13FO3 — CID 117302939
3-(5-fluoro-2-hydroxyphenyl)-2,2-dimethylpropanoic acid (PubChem CID 117302939) has the molecular formula C11H13FO3 and a molecular weight of 212.22 g/mol. Its IUPAC name is 3-(5-fluoro-2-hydroxyphenyl)-2,2-dimethylpropanoic acid.
| Compound Name | 3-(5-fluoro-2-hydroxyphenyl)-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 117302939 |
| Molecular Formula | C11H13FO3 |
| Molecular Weight | 212.22 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 3-(5-fluoro-2-hydroxyphenyl)-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(Cc1cc(F)ccc1O)C(=O)O |
| InChI | InChI=1S/C11H13FO3/c1-11(2,10(14)15)6-7-5-8(12)3-4-9(7)13/h3-5,13H,6H2,1-2H3,(H,14,15) |
| InChIKey | OGQCBYWFEBHFFL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.22 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |