C12H17ClO — CID 117303450
2-(2-chloro-3,5-dimethylphenyl)-2-methylpropan-1-ol (PubChem CID 117303450) has the molecular formula C12H17ClO and a molecular weight of 212.72 g/mol. Its IUPAC name is 2-(2-chloro-3,5-dimethylphenyl)-2-methylpropan-1-ol.
| Compound Name | 2-(2-chloro-3,5-dimethylphenyl)-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 117303450 |
| Molecular Formula | C12H17ClO |
| Molecular Weight | 212.72 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 2-(2-chloro-3,5-dimethylphenyl)-2-methylpropan-1-ol |
| SMILES | Cc1cc(C)c(Cl)c(C(C)(C)CO)c1 |
| InChI | InChI=1S/C12H17ClO/c1-8-5-9(2)11(13)10(6-8)12(3,4)7-14/h5-6,14H,7H2,1-4H3 |
| InChIKey | JUEISCGJGVQKJV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.72 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |