About 3-[2-(1,1-difluoroethyl)-5-methylphenyl]propan-1-amine
3-[2-(1,1-difluoroethyl)-5-methylphenyl]propan-1-amine (PubChem CID 117304320) has the molecular formula C12H17F2N
and a molecular weight of 213.27 g/mol. Its IUPAC name is 3-[2-(1,1-difluoroethyl)-5-methylphenyl]propan-1-amine.
Molecular Properties
| Compound Name | 3-[2-(1,1-difluoroethyl)-5-methylphenyl]propan-1-amine |
| PubChem CID | 117304320 |
| Molecular Formula | C12H17F2N |
| Molecular Weight | 213.27 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 3-[2-(1,1-difluoroethyl)-5-methylphenyl]propan-1-amine |
| SMILES | Cc1ccc(C(C)(F)F)c(CCCN)c1 |
| InChI | InChI=1S/C12H17F2N/c1-9-5-6-11(12(2,13)14)10(8-9)4-3-7-15/h5-6,8H,3-4,7,15H2,1-2H3 |
| InChIKey | PMEQYHPNCCMLIT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[2-(1,1-difluoroethyl)-5-methylphenyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(1,1-difluoroethyl)-5-methylphenyl]propan-1-amine?
The IUPAC name of 3-[2-(1,1-difluoroethyl)-5-methylphenyl]propan-1-amine (CID 117304320) is 3-[2-(1,1-difluoroethyl)-5-methylphenyl]propan-1-amine.
What is the SMILES notation for 3-[2-(1,1-difluoroethyl)-5-methylphenyl]propan-1-amine?
The canonical SMILES for 3-[2-(1,1-difluoroethyl)-5-methylphenyl]propan-1-amine is Cc1ccc(C(C)(F)F)c(CCCN)c1.
What is the InChIKey of 3-[2-(1,1-difluoroethyl)-5-methylphenyl]propan-1-amine?
The InChIKey is PMEQYHPNCCMLIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F2N/c1-9-5-6-11(12(2,13)14)10(8-9)4-3-7-15/h5-6,8H,3-4,7,15H2,1-2H3.
What are the key properties of 3-[2-(1,1-difluoroethyl)-5-methylphenyl]propan-1-amine?
3-[2-(1,1-difluoroethyl)-5-methylphenyl]propan-1-amine has a molecular weight of 213.27 g/mol, XLogP of 3.00, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(1,1-difluoroethyl)-5-methylphenyl]propan-1-amine is sourced from PubChem (CID 117304320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).