About 1-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]-4-phenylbutan-1-one
1-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]-4-phenylbutan-1-one (PubChem CID 11730467) has the molecular formula C30H34F2N2O
and a molecular weight of 476.61 g/mol. Its IUPAC name is 1-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]-4-phenylbutan-1-one.
Molecular Properties
| Compound Name | 1-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]-4-phenylbutan-1-one |
| PubChem CID | 11730467 |
| Molecular Formula | C30H34F2N2O |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | 1-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]-4-phenylbutan-1-one |
| SMILES | O=C(CCCc1ccccc1)N1CCN(CCCC(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C30H34F2N2O/c31-27-15-11-25(12-16-27)29(26-13-17-28(32)18-14-26)9-5-19-33-20-22-34(23-21-33)30(35)10-4-8-24-6-2-1-3-7-24/h1-3,6-7,11-18,29H,4-5,8-10,19-23H2 |
| InChIKey | VGBOISIRCIDEGP-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]-4-phenylbutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]-4-phenylbutan-1-one?
The IUPAC name of 1-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]-4-phenylbutan-1-one (CID 11730467) is 1-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]-4-phenylbutan-1-one.
What is the SMILES notation for 1-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]-4-phenylbutan-1-one?
The canonical SMILES for 1-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]-4-phenylbutan-1-one is O=C(CCCc1ccccc1)N1CCN(CCCC(c2ccc(F)cc2)c2ccc(F)cc2)CC1.
What is the InChIKey of 1-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]-4-phenylbutan-1-one?
The InChIKey is VGBOISIRCIDEGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H34F2N2O/c31-27-15-11-25(12-16-27)29(26-13-17-28(32)18-14-26)9-5-19-33-20-22-34(23-21-33)30(35)10-4-8-24-6-2-1-3-7-24/h1-3,6-7,11-18,29H,4-5,8-10,19-23H2.
What are the key properties of 1-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]-4-phenylbutan-1-one?
1-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]-4-phenylbutan-1-one has a molecular weight of 476.61 g/mol, XLogP of 6.04, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]-4-phenylbutan-1-one is sourced from PubChem (CID 11730467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).