C30H32O2Si2 — CID 11730530
trimethyl-[(10-trimethylsilyloxy-3-hexacyclo[10.6.6.02,11.04,9.013,18.019,24]tetracosa-2,4,6,8,10,13,15,17,19,21,23-undecaenyl)oxy]silane (PubChem CID 11730530) has the molecular formula C30H32O2Si2 and a molecular weight of 480.76 g/mol. Its IUPAC name is trimethyl-[(10-trimethylsilyloxy-3-hexacyclo[10.6.6.02,11.04,9.013,18.019,24]tetracosa-2,4,6,8,10,13,15,17,19,21,23-undecaenyl)oxy]silane.
| Compound Name | trimethyl-[(10-trimethylsilyloxy-3-hexacyclo[10.6.6.02,11.04,9.013,18.019,24]tetracosa-2,4,6,8,10,13,15,17,19,21,23-undecaenyl)oxy]silane |
|---|---|
| PubChem CID | 11730530 |
| Molecular Formula | C30H32O2Si2 |
| Molecular Weight | 480.76 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | trimethyl-[(10-trimethylsilyloxy-3-hexacyclo[10.6.6.02,11.04,9.013,18.019,24]tetracosa-2,4,6,8,10,13,15,17,19,21,23-undecaenyl)oxy]silane |
| SMILES | C[Si](C)(C)Oc1c2c(c(O[Si](C)(C)C)c3ccccc13)C1c3ccccc3C2c2ccccc21 |
| InChI | InChI=1S/C30H32O2Si2/c1-33(2,3)31-29-23-17-11-12-18-24(23)30(32-34(4,5)6)28-26-21-15-9-7-13-19(21)25(27(28)29)20-14-8-10-16-22(20)26/h7-18,25-26H,1-6H3 |
| InChIKey | FLUSOARTGUVZNH-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.76 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|