C14H17NO — CID 117307014
1-[1-(3-methyl-1-benzofuran-7-yl)cyclopropyl]ethanamine (PubChem CID 117307014) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is 1-[1-(3-methyl-1-benzofuran-7-yl)cyclopropyl]ethanamine.
| Compound Name | 1-[1-(3-methyl-1-benzofuran-7-yl)cyclopropyl]ethanamine |
|---|---|
| PubChem CID | 117307014 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 1-[1-(3-methyl-1-benzofuran-7-yl)cyclopropyl]ethanamine |
| SMILES | Cc1coc2c(C3(C(C)N)CC3)cccc12 |
| InChI | InChI=1S/C14H17NO/c1-9-8-16-13-11(9)4-3-5-12(13)14(6-7-14)10(2)15/h3-5,8,10H,6-7,15H2,1-2H3 |
| InChIKey | GKAMXYLXFHLUPA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |