C30H36O6 — CID 11730706
9-O-(9H-fluoren-9-ylmethyl) 1-O-methyl (E,2S)-2-hydroxy-2-[(1R,2S)-1-hydroxy-2-methylbutyl]-6-methylidenenon-3-enedioate (PubChem CID 11730706) has the molecular formula C30H36O6 and a molecular weight of 492.61 g/mol. Its IUPAC name is 9-O-(9H-fluoren-9-ylmethyl) 1-O-methyl (E,2S)-2-hydroxy-2-[(1R,2S)-1-hydroxy-2-methylbutyl]-6-methylidenenon-3-enedioate.
| Compound Name | 9-O-(9H-fluoren-9-ylmethyl) 1-O-methyl (E,2S)-2-hydroxy-2-[(1R,2S)-1-hydroxy-2-methylbutyl]-6-methylidenenon-3-enedioate |
|---|---|
| PubChem CID | 11730706 |
| Molecular Formula | C30H36O6 |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | 9-O-(9H-fluoren-9-ylmethyl) 1-O-methyl (E,2S)-2-hydroxy-2-[(1R,2S)-1-hydroxy-2-methylbutyl]-6-methylidenenon-3-enedioate |
| SMILES | C=C(C/C=C/[C@@](O)(C(=O)OC)[C@H](O)[C@@H](C)CC)CCC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C30H36O6/c1-5-21(3)28(32)30(34,29(33)35-4)18-10-11-20(2)16-17-27(31)36-19-26-24-14-8-6-12-22(24)23-13-7-9-15-25(23)26/h6-10,12-15,18,21,26,28,32,34H,2,5,11,16-17,19H2,1,3-4H3/b18-10+/t21-,28+,30-/m0/s1 |
| InChIKey | UZZVHYLRYIJBJH-XIWAIESQSA-N |
| XLogP | 4.94 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|