About 6-[(E)-3-aminoprop-1-enyl]-5-chlorobenzene-1,2,4-triol
6-[(E)-3-aminoprop-1-enyl]-5-chlorobenzene-1,2,4-triol (PubChem CID 117307221) has the molecular formula C9H10ClNO3
and a molecular weight of 215.64 g/mol. Its IUPAC name is 6-[(E)-3-aminoprop-1-enyl]-5-chlorobenzene-1,2,4-triol.
Molecular Properties
| Compound Name | 6-[(E)-3-aminoprop-1-enyl]-5-chlorobenzene-1,2,4-triol |
| PubChem CID | 117307221 |
| Molecular Formula | C9H10ClNO3 |
| Molecular Weight | 215.64 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | 6-[(E)-3-aminoprop-1-enyl]-5-chlorobenzene-1,2,4-triol |
| SMILES | NC/C=C/c1c(O)c(O)cc(O)c1Cl |
| InChI | InChI=1S/C9H10ClNO3/c10-8-5(2-1-3-11)9(14)7(13)4-6(8)12/h1-2,4,12-14H,3,11H2/b2-1+ |
| InChIKey | YYIFEFLZGPFJGW-OWOJBTEDSA-N |
| XLogP | 1.43 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.64 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 6-[(E)-3-aminoprop-1-enyl]-5-chlorobenzene-1,2,4-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(E)-3-aminoprop-1-enyl]-5-chlorobenzene-1,2,4-triol?
The IUPAC name of 6-[(E)-3-aminoprop-1-enyl]-5-chlorobenzene-1,2,4-triol (CID 117307221) is 6-[(E)-3-aminoprop-1-enyl]-5-chlorobenzene-1,2,4-triol.
What is the SMILES notation for 6-[(E)-3-aminoprop-1-enyl]-5-chlorobenzene-1,2,4-triol?
The canonical SMILES for 6-[(E)-3-aminoprop-1-enyl]-5-chlorobenzene-1,2,4-triol is NC/C=C/c1c(O)c(O)cc(O)c1Cl.
What is the InChIKey of 6-[(E)-3-aminoprop-1-enyl]-5-chlorobenzene-1,2,4-triol?
The InChIKey is YYIFEFLZGPFJGW-OWOJBTEDSA-N. The full InChI is InChI=1S/C9H10ClNO3/c10-8-5(2-1-3-11)9(14)7(13)4-6(8)12/h1-2,4,12-14H,3,11H2/b2-1+.
What are the key properties of 6-[(E)-3-aminoprop-1-enyl]-5-chlorobenzene-1,2,4-triol?
6-[(E)-3-aminoprop-1-enyl]-5-chlorobenzene-1,2,4-triol has a molecular weight of 215.64 g/mol, XLogP of 1.43, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(E)-3-aminoprop-1-enyl]-5-chlorobenzene-1,2,4-triol is sourced from PubChem (CID 117307221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).