C25H44O8Si — CID 11730804
3-[(1R,2S,5E,7E)-1,2-bis(methoxymethoxy)-4,4-dimethyl-9-(2-trimethylsilylethoxymethoxy)nona-5,7-dienyl]-2H-furan-5-one (PubChem CID 11730804) has the molecular formula C25H44O8Si and a molecular weight of 500.71 g/mol. Its IUPAC name is 3-[(1R,2S,5E,7E)-1,2-bis(methoxymethoxy)-4,4-dimethyl-9-(2-trimethylsilylethoxymethoxy)nona-5,7-dienyl]-2H-furan-5-one.
| Compound Name | 3-[(1R,2S,5E,7E)-1,2-bis(methoxymethoxy)-4,4-dimethyl-9-(2-trimethylsilylethoxymethoxy)nona-5,7-dienyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 11730804 |
| Molecular Formula | C25H44O8Si |
| Molecular Weight | 500.71 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | 3-[(1R,2S,5E,7E)-1,2-bis(methoxymethoxy)-4,4-dimethyl-9-(2-trimethylsilylethoxymethoxy)nona-5,7-dienyl]-2H-furan-5-one |
| SMILES | COCO[C@@H](CC(C)(C)/C=C/C=C/COCOCC[Si](C)(C)C)[C@H](OCOC)C1=CC(=O)OC1 |
| InChI | InChI=1S/C25H44O8Si/c1-25(2,11-9-8-10-12-29-20-30-13-14-34(5,6)7)16-22(32-18-27-3)24(33-19-28-4)21-15-23(26)31-17-21/h8-11,15,22,24H,12-14,16-20H2,1-7H3/b10-8+,11-9+/t22-,24+/m0/s1 |
| InChIKey | HISGPALJYCMXTM-QFKSUSATSA-N |
| XLogP | 4.31 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.71 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|