C10H10F2OS — CID 117308101
1-(2,5-difluoro-4-methylsulfanylphenyl)cyclopropan-1-ol (PubChem CID 117308101) has the molecular formula C10H10F2OS and a molecular weight of 216.25 g/mol. Its IUPAC name is 1-(2,5-difluoro-4-methylsulfanylphenyl)cyclopropan-1-ol.
| Compound Name | 1-(2,5-difluoro-4-methylsulfanylphenyl)cyclopropan-1-ol |
|---|---|
| PubChem CID | 117308101 |
| Molecular Formula | C10H10F2OS |
| Molecular Weight | 216.25 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 1-(2,5-difluoro-4-methylsulfanylphenyl)cyclopropan-1-ol |
| SMILES | CSc1cc(F)c(C2(O)CC2)cc1F |
| InChI | InChI=1S/C10H10F2OS/c1-14-9-5-7(11)6(4-8(9)12)10(13)2-3-10/h4-5,13H,2-3H2,1H3 |
| InChIKey | YZTGZFZYLIPLON-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |