C10H8N4S — CID 117308135
5-(1,2-benzothiazol-5-yl)-1H-pyrazol-3-amine (PubChem CID 117308135) has the molecular formula C10H8N4S and a molecular weight of 216.27 g/mol. Its IUPAC name is 5-(1,2-benzothiazol-5-yl)-1H-pyrazol-3-amine.
| Compound Name | 5-(1,2-benzothiazol-5-yl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 117308135 |
| Molecular Formula | C10H8N4S |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 5-(1,2-benzothiazol-5-yl)-1H-pyrazol-3-amine |
| SMILES | Nc1cc(-c2ccc3sncc3c2)[nH]n1 |
| InChI | InChI=1S/C10H8N4S/c11-10-4-8(13-14-10)6-1-2-9-7(3-6)5-12-15-9/h1-5H,(H3,11,13,14) |
| InChIKey | RCIDFXASRZFERS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |