About 2-tert-butyl-1,3-benzothiazole-5-carbonitrile
2-tert-butyl-1,3-benzothiazole-5-carbonitrile (PubChem CID 117308454) has the molecular formula C12H12N2S
and a molecular weight of 216.31 g/mol. Its IUPAC name is 2-tert-butyl-1,3-benzothiazole-5-carbonitrile.
Molecular Properties
| Compound Name | 2-tert-butyl-1,3-benzothiazole-5-carbonitrile |
| PubChem CID | 117308454 |
| Molecular Formula | C12H12N2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 2-tert-butyl-1,3-benzothiazole-5-carbonitrile |
| SMILES | CC(C)(C)c1nc2cc(C#N)ccc2s1 |
| InChI | InChI=1S/C12H12N2S/c1-12(2,3)11-14-9-6-8(7-13)4-5-10(9)15-11/h4-6H,1-3H3 |
| InChIKey | ZJFUSBFVVFEDRG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-tert-butyl-1,3-benzothiazole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-1,3-benzothiazole-5-carbonitrile?
The IUPAC name of 2-tert-butyl-1,3-benzothiazole-5-carbonitrile (CID 117308454) is 2-tert-butyl-1,3-benzothiazole-5-carbonitrile.
What is the SMILES notation for 2-tert-butyl-1,3-benzothiazole-5-carbonitrile?
The canonical SMILES for 2-tert-butyl-1,3-benzothiazole-5-carbonitrile is CC(C)(C)c1nc2cc(C#N)ccc2s1.
What is the InChIKey of 2-tert-butyl-1,3-benzothiazole-5-carbonitrile?
The InChIKey is ZJFUSBFVVFEDRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2S/c1-12(2,3)11-14-9-6-8(7-13)4-5-10(9)15-11/h4-6H,1-3H3.
What are the key properties of 2-tert-butyl-1,3-benzothiazole-5-carbonitrile?
2-tert-butyl-1,3-benzothiazole-5-carbonitrile has a molecular weight of 216.31 g/mol, XLogP of 3.47, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-1,3-benzothiazole-5-carbonitrile is sourced from PubChem (CID 117308454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).