C30H50O4S — CID 11730883
(Z,5S,8R)-2,2,6-trimethyl-8-methylsulfonyl-5-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]non-6-en-3-one (PubChem CID 11730883) has the molecular formula C30H50O4S and a molecular weight of 506.79 g/mol. Its IUPAC name is (Z,5S,8R)-2,2,6-trimethyl-8-methylsulfonyl-5-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]non-6-en-3-one.
| Compound Name | (Z,5S,8R)-2,2,6-trimethyl-8-methylsulfonyl-5-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]non-6-en-3-one |
|---|---|
| PubChem CID | 11730883 |
| Molecular Formula | C30H50O4S |
| Molecular Weight | 506.79 g/mol |
| Exact Mass | 506.34 |
| IUPAC Name | (Z,5S,8R)-2,2,6-trimethyl-8-methylsulfonyl-5-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]non-6-en-3-one |
| SMILES | C/C(=C/[C@@H](C)S(C)(=O)=O)[C@H](CC(=O)C(C)(C)C)O[C@@H](C)c1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C30H50O4S/c1-18(2)24-15-25(19(3)4)29(26(16-24)20(5)6)23(9)34-27(17-28(31)30(10,11)12)21(7)14-22(8)35(13,32)33/h14-16,18-20,22-23,27H,17H2,1-13H3/b21-14-/t22-,23+,27+/m1/s1 |
| InChIKey | QJTXTGNMIPVKAM-FDFIRSDTSA-N |
| XLogP | 7.89 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.79 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|