C28H38O7Si — CID 11730960
[(2S,3S,4S,5R,6R)-5-acetyloxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-4-methyloxan-3-yl] acetate (PubChem CID 11730960) has the molecular formula C28H38O7Si and a molecular weight of 514.69 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6R)-5-acetyloxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-4-methyloxan-3-yl] acetate.
| Compound Name | [(2S,3S,4S,5R,6R)-5-acetyloxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-4-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 11730960 |
| Molecular Formula | C28H38O7Si |
| Molecular Weight | 514.69 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | [(2S,3S,4S,5R,6R)-5-acetyloxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-4-methyloxan-3-yl] acetate |
| SMILES | CO[C@@H]1O[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](OC(C)=O)[C@H](C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C28H38O7Si/c1-19-25(33-20(2)29)24(35-27(31-7)26(19)34-21(3)30)18-32-36(28(4,5)6,22-14-10-8-11-15-22)23-16-12-9-13-17-23/h8-17,19,24-27H,18H2,1-7H3/t19-,24-,25-,26+,27+/m0/s1 |
| InChIKey | ZBBRZKICAYDFFQ-VMHSGMROSA-N |
| XLogP | 3.43 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.69 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|