About 2-[1-(1-aminoethyl)cyclopropyl]-4,5-dimethylbenzaldehyde
2-[1-(1-aminoethyl)cyclopropyl]-4,5-dimethylbenzaldehyde (PubChem CID 117309973) has the molecular formula C14H19NO
and a molecular weight of 217.31 g/mol. Its IUPAC name is 2-[1-(1-aminoethyl)cyclopropyl]-4,5-dimethylbenzaldehyde.
Molecular Properties
| Compound Name | 2-[1-(1-aminoethyl)cyclopropyl]-4,5-dimethylbenzaldehyde |
| PubChem CID | 117309973 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 2-[1-(1-aminoethyl)cyclopropyl]-4,5-dimethylbenzaldehyde |
| SMILES | Cc1cc(C=O)c(C2(C(C)N)CC2)cc1C |
| InChI | InChI=1S/C14H19NO/c1-9-6-12(8-16)13(7-10(9)2)14(4-5-14)11(3)15/h6-8,11H,4-5,15H2,1-3H3 |
| InChIKey | BDFPMWIZIURYSY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-(1-aminoethyl)cyclopropyl]-4,5-dimethylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(1-aminoethyl)cyclopropyl]-4,5-dimethylbenzaldehyde?
The IUPAC name of 2-[1-(1-aminoethyl)cyclopropyl]-4,5-dimethylbenzaldehyde (CID 117309973) is 2-[1-(1-aminoethyl)cyclopropyl]-4,5-dimethylbenzaldehyde.
What is the SMILES notation for 2-[1-(1-aminoethyl)cyclopropyl]-4,5-dimethylbenzaldehyde?
The canonical SMILES for 2-[1-(1-aminoethyl)cyclopropyl]-4,5-dimethylbenzaldehyde is Cc1cc(C=O)c(C2(C(C)N)CC2)cc1C.
What is the InChIKey of 2-[1-(1-aminoethyl)cyclopropyl]-4,5-dimethylbenzaldehyde?
The InChIKey is BDFPMWIZIURYSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO/c1-9-6-12(8-16)13(7-10(9)2)14(4-5-14)11(3)15/h6-8,11H,4-5,15H2,1-3H3.
What are the key properties of 2-[1-(1-aminoethyl)cyclopropyl]-4,5-dimethylbenzaldehyde?
2-[1-(1-aminoethyl)cyclopropyl]-4,5-dimethylbenzaldehyde has a molecular weight of 217.31 g/mol, XLogP of 2.49, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(1-aminoethyl)cyclopropyl]-4,5-dimethylbenzaldehyde is sourced from PubChem (CID 117309973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).