C13H19N3 — CID 117310008
4-[4-(4,5-dihydroimidazol-1-yl)phenyl]butan-1-amine (PubChem CID 117310008) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 4-[4-(4,5-dihydroimidazol-1-yl)phenyl]butan-1-amine.
| Compound Name | 4-[4-(4,5-dihydroimidazol-1-yl)phenyl]butan-1-amine |
|---|---|
| PubChem CID | 117310008 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 4-[4-(4,5-dihydroimidazol-1-yl)phenyl]butan-1-amine |
| SMILES | NCCCCc1ccc(N2C=NCC2)cc1 |
| InChI | InChI=1S/C13H19N3/c14-8-2-1-3-12-4-6-13(7-5-12)16-10-9-15-11-16/h4-7,11H,1-3,8-10,14H2 |
| InChIKey | SEZGKFSLBOHISY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|