C11H10N2O3 — CID 117310663
4-(2,3-dihydro-1,4-benzodioxin-5-yl)-1,2-oxazol-5-amine (PubChem CID 117310663) has the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,4-benzodioxin-5-yl)-1,2-oxazol-5-amine.
| Compound Name | 4-(2,3-dihydro-1,4-benzodioxin-5-yl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117310663 |
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 4-(2,3-dihydro-1,4-benzodioxin-5-yl)-1,2-oxazol-5-amine |
| SMILES | Nc1oncc1-c1cccc2c1OCCO2 |
| InChI | InChI=1S/C11H10N2O3/c12-11-8(6-13-16-11)7-2-1-3-9-10(7)15-5-4-14-9/h1-3,6H,4-5,12H2 |
| InChIKey | SQTYEVHVKRRSDP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |