About 3-(2,5-difluoro-3-methylsulfanylphenyl)propan-1-ol
3-(2,5-difluoro-3-methylsulfanylphenyl)propan-1-ol (PubChem CID 117311078) has the molecular formula C10H12F2OS
and a molecular weight of 218.27 g/mol. Its IUPAC name is 3-(2,5-difluoro-3-methylsulfanylphenyl)propan-1-ol.
Molecular Properties
| Compound Name | 3-(2,5-difluoro-3-methylsulfanylphenyl)propan-1-ol |
| PubChem CID | 117311078 |
| Molecular Formula | C10H12F2OS |
| Molecular Weight | 218.27 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 3-(2,5-difluoro-3-methylsulfanylphenyl)propan-1-ol |
| SMILES | CSc1cc(F)cc(CCCO)c1F |
| InChI | InChI=1S/C10H12F2OS/c1-14-9-6-8(11)5-7(10(9)12)3-2-4-13/h5-6,13H,2-4H2,1H3 |
| InChIKey | YMMLRRRDBHMJRB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2,5-difluoro-3-methylsulfanylphenyl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-difluoro-3-methylsulfanylphenyl)propan-1-ol?
The IUPAC name of 3-(2,5-difluoro-3-methylsulfanylphenyl)propan-1-ol (CID 117311078) is 3-(2,5-difluoro-3-methylsulfanylphenyl)propan-1-ol.
What is the SMILES notation for 3-(2,5-difluoro-3-methylsulfanylphenyl)propan-1-ol?
The canonical SMILES for 3-(2,5-difluoro-3-methylsulfanylphenyl)propan-1-ol is CSc1cc(F)cc(CCCO)c1F.
What is the InChIKey of 3-(2,5-difluoro-3-methylsulfanylphenyl)propan-1-ol?
The InChIKey is YMMLRRRDBHMJRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F2OS/c1-14-9-6-8(11)5-7(10(9)12)3-2-4-13/h5-6,13H,2-4H2,1H3.
What are the key properties of 3-(2,5-difluoro-3-methylsulfanylphenyl)propan-1-ol?
3-(2,5-difluoro-3-methylsulfanylphenyl)propan-1-ol has a molecular weight of 218.27 g/mol, XLogP of 2.61, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-difluoro-3-methylsulfanylphenyl)propan-1-ol is sourced from PubChem (CID 117311078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).