C26H48O7Si2 — CID 11731126
dimethyl (1R,3S,5R,6S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3,4,5,6,7-hexahydro-2-benzofuran-5,6-dicarboxylate (PubChem CID 11731126) has the molecular formula C26H48O7Si2 and a molecular weight of 528.84 g/mol. Its IUPAC name is dimethyl (1R,3S,5R,6S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3,4,5,6,7-hexahydro-2-benzofuran-5,6-dicarboxylate.
| Compound Name | dimethyl (1R,3S,5R,6S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3,4,5,6,7-hexahydro-2-benzofuran-5,6-dicarboxylate |
|---|---|
| PubChem CID | 11731126 |
| Molecular Formula | C26H48O7Si2 |
| Molecular Weight | 528.84 g/mol |
| Exact Mass | 528.29 |
| IUPAC Name | dimethyl (1R,3S,5R,6S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3,4,5,6,7-hexahydro-2-benzofuran-5,6-dicarboxylate |
| SMILES | COC(=O)[C@H]1CC2=C(C[C@H]1C(=O)OC)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H]2CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H48O7Si2/c1-25(2,3)34(9,10)31-15-21-17-13-19(23(27)29-7)20(24(28)30-8)14-18(17)22(33-21)16-32-35(11,12)26(4,5)6/h19-22H,13-16H2,1-12H3/t19-,20+,21-,22+ |
| InChIKey | LZQQAAIJHBONPN-COPRSSIGSA-N |
| XLogP | 5.47 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.84 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|