About 5-(6-fluoro-2,3-dihydro-1-benzofuran-5-yl)-1H-pyrazol-3-amine
5-(6-fluoro-2,3-dihydro-1-benzofuran-5-yl)-1H-pyrazol-3-amine (PubChem CID 117311882) has the molecular formula C11H10FN3O
and a molecular weight of 219.22 g/mol. Its IUPAC name is 5-(6-fluoro-2,3-dihydro-1-benzofuran-5-yl)-1H-pyrazol-3-amine.
Molecular Properties
| Compound Name | 5-(6-fluoro-2,3-dihydro-1-benzofuran-5-yl)-1H-pyrazol-3-amine |
| PubChem CID | 117311882 |
| Molecular Formula | C11H10FN3O |
| Molecular Weight | 219.22 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 5-(6-fluoro-2,3-dihydro-1-benzofuran-5-yl)-1H-pyrazol-3-amine |
| SMILES | Nc1cc(-c2cc3c(cc2F)OCC3)[nH]n1 |
| InChI | InChI=1S/C11H10FN3O/c12-8-4-10-6(1-2-16-10)3-7(8)9-5-11(13)15-14-9/h3-5H,1-2H2,(H3,13,14,15) |
| InChIKey | TYJZMDJXAGCQOZ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(6-fluoro-2,3-dihydro-1-benzofuran-5-yl)-1H-pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(6-fluoro-2,3-dihydro-1-benzofuran-5-yl)-1H-pyrazol-3-amine?
The IUPAC name of 5-(6-fluoro-2,3-dihydro-1-benzofuran-5-yl)-1H-pyrazol-3-amine (CID 117311882) is 5-(6-fluoro-2,3-dihydro-1-benzofuran-5-yl)-1H-pyrazol-3-amine.
What is the SMILES notation for 5-(6-fluoro-2,3-dihydro-1-benzofuran-5-yl)-1H-pyrazol-3-amine?
The canonical SMILES for 5-(6-fluoro-2,3-dihydro-1-benzofuran-5-yl)-1H-pyrazol-3-amine is Nc1cc(-c2cc3c(cc2F)OCC3)[nH]n1.
What is the InChIKey of 5-(6-fluoro-2,3-dihydro-1-benzofuran-5-yl)-1H-pyrazol-3-amine?
The InChIKey is TYJZMDJXAGCQOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10FN3O/c12-8-4-10-6(1-2-16-10)3-7(8)9-5-11(13)15-14-9/h3-5H,1-2H2,(H3,13,14,15).
What are the key properties of 5-(6-fluoro-2,3-dihydro-1-benzofuran-5-yl)-1H-pyrazol-3-amine?
5-(6-fluoro-2,3-dihydro-1-benzofuran-5-yl)-1H-pyrazol-3-amine has a molecular weight of 219.22 g/mol, XLogP of 1.73, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(6-fluoro-2,3-dihydro-1-benzofuran-5-yl)-1H-pyrazol-3-amine is sourced from PubChem (CID 117311882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).