C32H50O5Si — CID 11731278
(2R,3R,4R,5R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-decyloxane-3,4,5-triol (PubChem CID 11731278) has the molecular formula C32H50O5Si and a molecular weight of 542.83 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-decyloxane-3,4,5-triol.
| Compound Name | (2R,3R,4R,5R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-decyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 11731278 |
| Molecular Formula | C32H50O5Si |
| Molecular Weight | 542.83 g/mol |
| Exact Mass | 542.34 |
| IUPAC Name | (2R,3R,4R,5R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-decyloxane-3,4,5-triol |
| SMILES | CCCCCCCCCC[C@@H]1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C32H50O5Si/c1-5-6-7-8-9-10-11-18-23-27-29(33)31(35)30(34)28(37-27)24-36-38(32(2,3)4,25-19-14-12-15-20-25)26-21-16-13-17-22-26/h12-17,19-22,27-31,33-35H,5-11,18,23-24H2,1-4H3/t27-,28+,29-,30-,31+/m0/s1 |
| InChIKey | GTPYAKHQYWWXPF-GKFQJYPJSA-N |
| XLogP | 4.94 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.83 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|