C22H24N6OS2 — CID 1173150
N-[4-(dimethylamino)phenyl]-2-[[(13S)-13-methyl-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-5-yl]sulfanyl]acetamide (PubChem CID 1173150) has the molecular formula C22H24N6OS2 and a molecular weight of 452.61 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-2-[[(13S)-13-methyl-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-5-yl]sulfanyl]acetamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-2-[[(13S)-13-methyl-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-5-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 1173150 |
| Molecular Formula | C22H24N6OS2 |
| Molecular Weight | 452.61 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-2-[[(13S)-13-methyl-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-5-yl]sulfanyl]acetamide |
| SMILES | C[C@H]1CCc2c(sc3ncn4c(SCC(=O)Nc5ccc(N(C)C)cc5)nnc4c23)C1 |
| InChI | InChI=1S/C22H24N6OS2/c1-13-4-9-16-17(10-13)31-21-19(16)20-25-26-22(28(20)12-23-21)30-11-18(29)24-14-5-7-15(8-6-14)27(2)3/h5-8,12-13H,4,9-11H2,1-3H3,(H,24,29)/t13-/m0/s1 |
| InChIKey | TYJURJDBQLGCCD-ZDUSSCGKSA-N |
| XLogP | 4.26 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.61 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|