About 2-[3-(1-methylpyridin-1-ium-4-yl)-5-methylsulfanyl-1,2,4-triazol-4-yl]ethanol iodide
2-[3-(1-methylpyridin-1-ium-4-yl)-5-methylsulfanyl-1,2,4-triazol-4-yl]ethanol iodide (PubChem CID 11731607) has the molecular formula C11H15IN4OS
and a molecular weight of 378.24 g/mol. Its IUPAC name is 2-[3-(1-methylpyridin-1-ium-4-yl)-5-methylsulfanyl-1,2,4-triazol-4-yl]ethanol iodide.
Molecular Properties
| Compound Name | 2-[3-(1-methylpyridin-1-ium-4-yl)-5-methylsulfanyl-1,2,4-triazol-4-yl]ethanol iodide |
| PubChem CID | 11731607 |
| Molecular Formula | C11H15IN4OS |
| Molecular Weight | 378.24 g/mol |
| Exact Mass | 378.00 |
| IUPAC Name | 2-[3-(1-methylpyridin-1-ium-4-yl)-5-methylsulfanyl-1,2,4-triazol-4-yl]ethanol iodide |
| SMILES | CSc1nnc(-c2cc[n+](C)cc2)n1CCO.[I-] |
| InChI | InChI=1S/C11H15N4OS.HI/c1-14-5-3-9(4-6-14)10-12-13-11(17-2)15(10)7-8-16;/h3-6,16H,7-8H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | JNBCBNYQKVXPTL-UHFFFAOYSA-M |
| XLogP | -2.51 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.24 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(1-methylpyridin-1-ium-4-yl)-5-methylsulfanyl-1,2,4-triazol-4-yl]ethanol iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(1-methylpyridin-1-ium-4-yl)-5-methylsulfanyl-1,2,4-triazol-4-yl]ethanol iodide?
The IUPAC name of 2-[3-(1-methylpyridin-1-ium-4-yl)-5-methylsulfanyl-1,2,4-triazol-4-yl]ethanol iodide (CID 11731607) is 2-[3-(1-methylpyridin-1-ium-4-yl)-5-methylsulfanyl-1,2,4-triazol-4-yl]ethanol iodide.
What is the SMILES notation for 2-[3-(1-methylpyridin-1-ium-4-yl)-5-methylsulfanyl-1,2,4-triazol-4-yl]ethanol iodide?
The canonical SMILES for 2-[3-(1-methylpyridin-1-ium-4-yl)-5-methylsulfanyl-1,2,4-triazol-4-yl]ethanol iodide is CSc1nnc(-c2cc[n+](C)cc2)n1CCO.[I-].
What is the InChIKey of 2-[3-(1-methylpyridin-1-ium-4-yl)-5-methylsulfanyl-1,2,4-triazol-4-yl]ethanol iodide?
The InChIKey is JNBCBNYQKVXPTL-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H15N4OS.HI/c1-14-5-3-9(4-6-14)10-12-13-11(17-2)15(10)7-8-16;/h3-6,16H,7-8H2,1-2H3;1H/q+1;/p-1.
What are the key properties of 2-[3-(1-methylpyridin-1-ium-4-yl)-5-methylsulfanyl-1,2,4-triazol-4-yl]ethanol iodide?
2-[3-(1-methylpyridin-1-ium-4-yl)-5-methylsulfanyl-1,2,4-triazol-4-yl]ethanol iodide has a molecular weight of 378.24 g/mol, XLogP of -2.51, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(1-methylpyridin-1-ium-4-yl)-5-methylsulfanyl-1,2,4-triazol-4-yl]ethanol iodide is sourced from PubChem (CID 11731607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).