C13H19NO2 — CID 117316559
1-[4-[1-(aminomethyl)cyclobutyl]phenyl]ethane-1,2-diol (PubChem CID 117316559) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 1-[4-[1-(aminomethyl)cyclobutyl]phenyl]ethane-1,2-diol.
| Compound Name | 1-[4-[1-(aminomethyl)cyclobutyl]phenyl]ethane-1,2-diol |
|---|---|
| PubChem CID | 117316559 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 1-[4-[1-(aminomethyl)cyclobutyl]phenyl]ethane-1,2-diol |
| SMILES | NCC1(c2ccc(C(O)CO)cc2)CCC1 |
| InChI | InChI=1S/C13H19NO2/c14-9-13(6-1-7-13)11-4-2-10(3-5-11)12(16)8-15/h2-5,12,15-16H,1,6-9,14H2 |
| InChIKey | LHIRMBXDLCCMFJ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |