C11H13NO4 — CID 117319304
8-[(hydroxyamino)methyl]-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-4-ol (PubChem CID 117319304) has the molecular formula C11H13NO4 and a molecular weight of 223.23 g/mol. Its IUPAC name is 8-[(hydroxyamino)methyl]-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-4-ol.
| Compound Name | 8-[(hydroxyamino)methyl]-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-4-ol |
|---|---|
| PubChem CID | 117319304 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 8-[(hydroxyamino)methyl]-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-4-ol |
| SMILES | ONCc1c2c(c(O)c3c1OCC3)OCC2 |
| InChI | InChI=1S/C11H13NO4/c13-9-7-2-4-15-10(7)8(5-12-14)6-1-3-16-11(6)9/h12-14H,1-5H2 |
| InChIKey | HQQZPZQHSYIUNP-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|