C24H42O4 — CID 11731986
2-[(3E,7E,11R)-11-(2,2-dimethoxyethyl)-4,8,12-trimethyltrideca-3,7,12-trienyl]-2-methyl-1,3-dioxolane (PubChem CID 11731986) has the molecular formula C24H42O4 and a molecular weight of 394.60 g/mol. Its IUPAC name is 2-[(3E,7E,11R)-11-(2,2-dimethoxyethyl)-4,8,12-trimethyltrideca-3,7,12-trienyl]-2-methyl-1,3-dioxolane.
| Compound Name | 2-[(3E,7E,11R)-11-(2,2-dimethoxyethyl)-4,8,12-trimethyltrideca-3,7,12-trienyl]-2-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 11731986 |
| Molecular Formula | C24H42O4 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.31 |
| IUPAC Name | 2-[(3E,7E,11R)-11-(2,2-dimethoxyethyl)-4,8,12-trimethyltrideca-3,7,12-trienyl]-2-methyl-1,3-dioxolane |
| SMILES | C=C(C)[C@H](CC/C(C)=C/CC/C(C)=C/CCC1(C)OCCO1)CC(OC)OC |
| InChI | InChI=1S/C24H42O4/c1-19(2)22(18-23(25-6)26-7)14-13-21(4)11-8-10-20(3)12-9-15-24(5)27-16-17-28-24/h11-12,22-23H,1,8-10,13-18H2,2-7H3/b20-12+,21-11+/t22-/m1/s1 |
| InChIKey | FFRNZTZWVOSJNZ-ICXJXOSJSA-N |
| XLogP | 6.18 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|