C13H21NO2 — CID 117320493
6-(2-amino-2-methylpropyl)-2-methoxy-3,4-dimethylphenol (PubChem CID 117320493) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 6-(2-amino-2-methylpropyl)-2-methoxy-3,4-dimethylphenol.
| Compound Name | 6-(2-amino-2-methylpropyl)-2-methoxy-3,4-dimethylphenol |
|---|---|
| PubChem CID | 117320493 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 6-(2-amino-2-methylpropyl)-2-methoxy-3,4-dimethylphenol |
| SMILES | COc1c(C)c(C)cc(CC(C)(C)N)c1O |
| InChI | InChI=1S/C13H21NO2/c1-8-6-10(7-13(3,4)14)11(15)12(16-5)9(8)2/h6,15H,7,14H2,1-5H3 |
| InChIKey | ORRPQDYFAUWISG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |