C21H34O7 — CID 11732067
[(2R,3S,4R)-3,4-bis(2,2-dimethylpropanoyloxy)-3,4-dihydro-2H-pyran-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 11732067) has the molecular formula C21H34O7 and a molecular weight of 398.50 g/mol. Its IUPAC name is [(2R,3S,4R)-3,4-bis(2,2-dimethylpropanoyloxy)-3,4-dihydro-2H-pyran-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,4R)-3,4-bis(2,2-dimethylpropanoyloxy)-3,4-dihydro-2H-pyran-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11732067 |
| Molecular Formula | C21H34O7 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | [(2R,3S,4R)-3,4-bis(2,2-dimethylpropanoyloxy)-3,4-dihydro-2H-pyran-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1OC=C[C@@H](OC(=O)C(C)(C)C)[C@@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C21H34O7/c1-19(2,3)16(22)26-12-14-15(28-18(24)21(7,8)9)13(10-11-25-14)27-17(23)20(4,5)6/h10-11,13-15H,12H2,1-9H3/t13-,14-,15+/m1/s1 |
| InChIKey | CPUWJJIRYNLNIR-KFWWJZLASA-N |
| XLogP | 3.40 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|