C20H38O4Si2 — CID 11732084
(1R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-6-oxabicyclo[3.1.0]hex-2-ene-2-carbaldehyde (PubChem CID 11732084) has the molecular formula C20H38O4Si2 and a molecular weight of 398.69 g/mol. Its IUPAC name is (1R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-6-oxabicyclo[3.1.0]hex-2-ene-2-carbaldehyde.
| Compound Name | (1R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-6-oxabicyclo[3.1.0]hex-2-ene-2-carbaldehyde |
|---|---|
| PubChem CID | 11732084 |
| Molecular Formula | C20H38O4Si2 |
| Molecular Weight | 398.69 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | (1R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-6-oxabicyclo[3.1.0]hex-2-ene-2-carbaldehyde |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)[C@]1(O[Si](C)(C)C(C)(C)C)C=C(C=O)[C@H]2O[C@H]21 |
| InChI | InChI=1S/C20H38O4Si2/c1-14(23-25(8,9)18(2,3)4)20(24-26(10,11)19(5,6)7)12-15(13-21)16-17(20)22-16/h12-14,16-17H,1-11H3/t14-,16+,17+,20+/m0/s1 |
| InChIKey | VVVZEDUGCFEBBO-CNVJLJKISA-N |
| XLogP | 5.06 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.69 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|