C27H29NO2 — CID 11732104
(4aR,6aR,6bS,9S,10aR,12aS)-6a,9-diphenyl-4,4a,5,6b,7,8,9,10,10a,12a-decahydro-1H-isoindolo[2,1-a][3,1]benzoxazin-11-one (PubChem CID 11732104) has the molecular formula C27H29NO2 and a molecular weight of 399.53 g/mol. Its IUPAC name is (4aR,6aR,6bS,9S,10aR,12aS)-6a,9-diphenyl-4,4a,5,6b,7,8,9,10,10a,12a-decahydro-1H-isoindolo[2,1-a][3,1]benzoxazin-11-one.
| Compound Name | (4aR,6aR,6bS,9S,10aR,12aS)-6a,9-diphenyl-4,4a,5,6b,7,8,9,10,10a,12a-decahydro-1H-isoindolo[2,1-a][3,1]benzoxazin-11-one |
|---|---|
| PubChem CID | 11732104 |
| Molecular Formula | C27H29NO2 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | (4aR,6aR,6bS,9S,10aR,12aS)-6a,9-diphenyl-4,4a,5,6b,7,8,9,10,10a,12a-decahydro-1H-isoindolo[2,1-a][3,1]benzoxazin-11-one |
| SMILES | O=C1[C@@H]2C[C@@H](c3ccccc3)CC[C@@H]2[C@]2(c3ccccc3)OC[C@@H]3CC=CC[C@@H]3N12 |
| InChI | InChI=1S/C27H29NO2/c29-26-23-17-20(19-9-3-1-4-10-19)15-16-24(23)27(22-12-5-2-6-13-22)28(26)25-14-8-7-11-21(25)18-30-27/h1-10,12-13,20-21,23-25H,11,14-18H2/t20-,21-,23+,24-,25-,27-/m0/s1 |
| InChIKey | JCQMBQVLSBOGGE-UTXRQYEQSA-N |
| XLogP | 5.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|