C20H40O6Si — CID 11732217
[(2S,3S,4R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-hydroxy-4-(methoxymethoxy)hex-5-enyl] 2,2-dimethylpropanoate (PubChem CID 11732217) has the molecular formula C20H40O6Si and a molecular weight of 404.62 g/mol. Its IUPAC name is [(2S,3S,4R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-hydroxy-4-(methoxymethoxy)hex-5-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(2S,3S,4R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-hydroxy-4-(methoxymethoxy)hex-5-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11732217 |
| Molecular Formula | C20H40O6Si |
| Molecular Weight | 404.62 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | [(2S,3S,4R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-hydroxy-4-(methoxymethoxy)hex-5-enyl] 2,2-dimethylpropanoate |
| SMILES | C=C[C@@H](OCOC)[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H](O)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C20H40O6Si/c1-11-17(25-14-23-8)15(12-26-27(9,10)20(5,6)7)16(21)13-24-18(22)19(2,3)4/h11,15-17,21H,1,12-14H2,2-10H3/t15-,16+,17+/m0/s1 |
| InChIKey | QHRBAHXVPKAXHB-GVDBMIGSSA-N |
| XLogP | 3.75 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.62 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|