C10H9F2N3O — CID 117322755
3-(5-amino-1-methylpyrazol-4-yl)-2,4-difluorophenol (PubChem CID 117322755) has the molecular formula C10H9F2N3O and a molecular weight of 225.20 g/mol. Its IUPAC name is 3-(5-amino-1-methylpyrazol-4-yl)-2,4-difluorophenol.
| Compound Name | 3-(5-amino-1-methylpyrazol-4-yl)-2,4-difluorophenol |
|---|---|
| PubChem CID | 117322755 |
| Molecular Formula | C10H9F2N3O |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 3-(5-amino-1-methylpyrazol-4-yl)-2,4-difluorophenol |
| SMILES | Cn1ncc(-c2c(F)ccc(O)c2F)c1N |
| InChI | InChI=1S/C10H9F2N3O/c1-15-10(13)5(4-14-15)8-6(11)2-3-7(16)9(8)12/h2-4,16H,13H2,1H3 |
| InChIKey | XTAJQEVOBGUPAH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |