C18H32O10 — CID 11732292
(1R,3S,5R,6R,8S,10R,12S,13S)-5,6,12,13-tetramethoxy-5,6,12,13-tetramethyl-4,7,11,14-tetraoxatricyclo[8.4.0.03,8]tetradecane-2,9-diol (PubChem CID 11732292) has the molecular formula C18H32O10 and a molecular weight of 408.44 g/mol. Its IUPAC name is (1R,3S,5R,6R,8S,10R,12S,13S)-5,6,12,13-tetramethoxy-5,6,12,13-tetramethyl-4,7,11,14-tetraoxatricyclo[8.4.0.03,8]tetradecane-2,9-diol.
| Compound Name | (1R,3S,5R,6R,8S,10R,12S,13S)-5,6,12,13-tetramethoxy-5,6,12,13-tetramethyl-4,7,11,14-tetraoxatricyclo[8.4.0.03,8]tetradecane-2,9-diol |
|---|---|
| PubChem CID | 11732292 |
| Molecular Formula | C18H32O10 |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | (1R,3S,5R,6R,8S,10R,12S,13S)-5,6,12,13-tetramethoxy-5,6,12,13-tetramethyl-4,7,11,14-tetraoxatricyclo[8.4.0.03,8]tetradecane-2,9-diol |
| SMILES | CO[C@@]1(C)O[C@@H]2C(O)[C@@H]3O[C@@](C)(OC)[C@](C)(OC)O[C@H]3C(O)[C@H]2O[C@]1(C)OC |
| InChI | InChI=1S/C18H32O10/c1-15(21-5)16(2,22-6)26-12-10(20)14-13(9(19)11(12)25-15)27-17(3,23-7)18(4,24-8)28-14/h9-14,19-20H,1-8H3/t9?,10?,11-,12-,13+,14+,15+,16+,17-,18- |
| InChIKey | FXLIBKBYQRHULW-OVOAFUDKSA-N |
| XLogP | -0.26 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |