C24H24N4OS — CID 1173230
1-(3,4-dihydro-2H-quinolin-1-yl)-2-[(4,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]ethanone (PubChem CID 1173230) has the molecular formula C24H24N4OS and a molecular weight of 416.55 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-quinolin-1-yl)-2-[(4,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]ethanone.
| Compound Name | 1-(3,4-dihydro-2H-quinolin-1-yl)-2-[(4,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 1173230 |
| Molecular Formula | C24H24N4OS |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 1-(3,4-dihydro-2H-quinolin-1-yl)-2-[(4,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]ethanone |
| SMILES | Cc1cc(C)c2c(c1)cc(C)c1nnc(SCC(=O)N3CCCc4ccccc43)n12 |
| InChI | InChI=1S/C24H24N4OS/c1-15-11-16(2)22-19(12-15)13-17(3)23-25-26-24(28(22)23)30-14-21(29)27-10-6-8-18-7-4-5-9-20(18)27/h4-5,7,9,11-13H,6,8,10,14H2,1-3H3 |
| InChIKey | HOGXVUDPSMVMNC-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |