About N-[[6-(methoxymethyl)-2,3-dihydro-1,4-benzodioxin-7-yl]methyl]hydroxylamine
N-[[6-(methoxymethyl)-2,3-dihydro-1,4-benzodioxin-7-yl]methyl]hydroxylamine (PubChem CID 117323158) has the molecular formula C11H15NO4
and a molecular weight of 225.24 g/mol. Its IUPAC name is N-[[6-(methoxymethyl)-2,3-dihydro-1,4-benzodioxin-7-yl]methyl]hydroxylamine.
Molecular Properties
| Compound Name | N-[[6-(methoxymethyl)-2,3-dihydro-1,4-benzodioxin-7-yl]methyl]hydroxylamine |
| PubChem CID | 117323158 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | N-[[6-(methoxymethyl)-2,3-dihydro-1,4-benzodioxin-7-yl]methyl]hydroxylamine |
| SMILES | COCc1cc2c(cc1CNO)OCCO2 |
| InChI | InChI=1S/C11H15NO4/c1-14-7-9-5-11-10(15-2-3-16-11)4-8(9)6-12-13/h4-5,12-13H,2-3,6-7H2,1H3 |
| InChIKey | XSJIOGPQJIDDDP-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[[6-(methoxymethyl)-2,3-dihydro-1,4-benzodioxin-7-yl]methyl]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[6-(methoxymethyl)-2,3-dihydro-1,4-benzodioxin-7-yl]methyl]hydroxylamine?
The IUPAC name of N-[[6-(methoxymethyl)-2,3-dihydro-1,4-benzodioxin-7-yl]methyl]hydroxylamine (CID 117323158) is N-[[6-(methoxymethyl)-2,3-dihydro-1,4-benzodioxin-7-yl]methyl]hydroxylamine.
What is the SMILES notation for N-[[6-(methoxymethyl)-2,3-dihydro-1,4-benzodioxin-7-yl]methyl]hydroxylamine?
The canonical SMILES for N-[[6-(methoxymethyl)-2,3-dihydro-1,4-benzodioxin-7-yl]methyl]hydroxylamine is COCc1cc2c(cc1CNO)OCCO2.
What is the InChIKey of N-[[6-(methoxymethyl)-2,3-dihydro-1,4-benzodioxin-7-yl]methyl]hydroxylamine?
The InChIKey is XSJIOGPQJIDDDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO4/c1-14-7-9-5-11-10(15-2-3-16-11)4-8(9)6-12-13/h4-5,12-13H,2-3,6-7H2,1H3.
What are the key properties of N-[[6-(methoxymethyl)-2,3-dihydro-1,4-benzodioxin-7-yl]methyl]hydroxylamine?
N-[[6-(methoxymethyl)-2,3-dihydro-1,4-benzodioxin-7-yl]methyl]hydroxylamine has a molecular weight of 225.24 g/mol, XLogP of 1.08, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[6-(methoxymethyl)-2,3-dihydro-1,4-benzodioxin-7-yl]methyl]hydroxylamine is sourced from PubChem (CID 117323158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).