C12H16FNO2 — CID 117323606
3-(4-fluoro-2,6-dimethoxyphenyl)pyrrolidine (PubChem CID 117323606) has the molecular formula C12H16FNO2 and a molecular weight of 225.26 g/mol. Its IUPAC name is 3-(4-fluoro-2,6-dimethoxyphenyl)pyrrolidine.
| Compound Name | 3-(4-fluoro-2,6-dimethoxyphenyl)pyrrolidine |
|---|---|
| PubChem CID | 117323606 |
| Molecular Formula | C12H16FNO2 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 3-(4-fluoro-2,6-dimethoxyphenyl)pyrrolidine |
| SMILES | COc1cc(F)cc(OC)c1C1CCNC1 |
| InChI | InChI=1S/C12H16FNO2/c1-15-10-5-9(13)6-11(16-2)12(10)8-3-4-14-7-8/h5-6,8,14H,3-4,7H2,1-2H3 |
| InChIKey | IZFMRMNFQQTCCM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |