C18H17N5OS2 — CID 1173241
N-(1,3-thiazol-2-yl)-2-[(4,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]acetamide (PubChem CID 1173241) has the molecular formula C18H17N5OS2 and a molecular weight of 383.50 g/mol. Its IUPAC name is N-(1,3-thiazol-2-yl)-2-[(4,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]acetamide.
| Compound Name | N-(1,3-thiazol-2-yl)-2-[(4,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 1173241 |
| Molecular Formula | C18H17N5OS2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | N-(1,3-thiazol-2-yl)-2-[(4,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]acetamide |
| SMILES | Cc1cc(C)c2c(c1)cc(C)c1nnc(SCC(=O)Nc3nccs3)n12 |
| InChI | InChI=1S/C18H17N5OS2/c1-10-6-11(2)15-13(7-10)8-12(3)16-21-22-18(23(15)16)26-9-14(24)20-17-19-4-5-25-17/h4-8H,9H2,1-3H3,(H,19,20,24) |
| InChIKey | KREZWFYUNBLKTL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |