C26H33N3O2 — CID 11732538
2a-[4-[4-(4-methoxyphenyl)piperazin-1-yl]butyl]-1,3,4,5-tetrahydrobenzo[cd]indol-2-one (PubChem CID 11732538) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is 2a-[4-[4-(4-methoxyphenyl)piperazin-1-yl]butyl]-1,3,4,5-tetrahydrobenzo[cd]indol-2-one.
| Compound Name | 2a-[4-[4-(4-methoxyphenyl)piperazin-1-yl]butyl]-1,3,4,5-tetrahydrobenzo[cd]indol-2-one |
|---|---|
| PubChem CID | 11732538 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | 2a-[4-[4-(4-methoxyphenyl)piperazin-1-yl]butyl]-1,3,4,5-tetrahydrobenzo[cd]indol-2-one |
| SMILES | COc1ccc(N2CCN(CCCCC34CCCc5cccc(c53)NC4=O)CC2)cc1 |
| InChI | InChI=1S/C26H33N3O2/c1-31-22-11-9-21(10-12-22)29-18-16-28(17-19-29)15-3-2-13-26-14-5-7-20-6-4-8-23(24(20)26)27-25(26)30/h4,6,8-12H,2-3,5,7,13-19H2,1H3,(H,27,30) |
| InChIKey | WOHIAPZKTUZQDB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|